About ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate
ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate (PubChem CID 3230466) has the molecular formula C22H29F2N3O4
and a molecular weight of 437.49 g/mol. Its IUPAC name is ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate |
| PubChem CID | 3230466 |
| Molecular Formula | C22H29F2N3O4 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2(NC(=O)Nc3ccc(F)cc3F)CCCCC2)CC1 |
| InChI | InChI=1S/C22H29F2N3O4/c1-2-31-19(28)15-8-12-27(13-9-15)20(29)22(10-4-3-5-11-22)26-21(30)25-18-7-6-16(23)14-17(18)24/h6-7,14-15H,2-5,8-13H2,1H3,(H2,25,26,30) |
| InChIKey | MLLJUAABWMDWBB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate (CID 3230466) is ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)C2(NC(=O)Nc3ccc(F)cc3F)CCCCC2)CC1.
What is the InChIKey of ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate?
The InChIKey is MLLJUAABWMDWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29F2N3O4/c1-2-31-19(28)15-8-12-27(13-9-15)20(29)22(10-4-3-5-11-22)26-21(30)25-18-7-6-16(23)14-17(18)24/h6-7,14-15H,2-5,8-13H2,1H3,(H2,25,26,30).
What are the key properties of ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate?
ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate has a molecular weight of 437.49 g/mol, XLogP of 3.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[1-[(2,4-difluorophenyl)carbamoylamino]cyclohexanecarbonyl]piperidine-4-carboxylate is sourced from PubChem (CID 3230466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).