C18H23F3N2O4S — CID 3230729
N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 3230729) has the molecular formula C18H23F3N2O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3230729 |
| Molecular Formula | C18H23F3N2O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H23F3N2O4S/c19-18(20,21)14-5-1-7-16(10-14)28(25,26)23-8-2-4-13(12-23)17(24)22-11-15-6-3-9-27-15/h1,5,7,10,13,15H,2-4,6,8-9,11-12H2,(H,22,24) |
| InChIKey | YDUCVENTETXRGN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |