About 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol
1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol (PubChem CID 3230765) has the molecular formula C14H16N6O
and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol |
| PubChem CID | 3230765 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol |
| SMILES | CC(O)CNc1ncnc2c1nnn2Cc1ccccc1 |
| InChI | InChI=1S/C14H16N6O/c1-10(21)7-15-13-12-14(17-9-16-13)20(19-18-12)8-11-5-3-2-4-6-11/h2-6,9-10,21H,7-8H2,1H3,(H,15,16,17) |
| InChIKey | BVNXSEPHYCPFGW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
The IUPAC name of 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol (CID 3230765) is 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol.
What is the SMILES notation for 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
The canonical SMILES for 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol is CC(O)CNc1ncnc2c1nnn2Cc1ccccc1.
What is the InChIKey of 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
The InChIKey is BVNXSEPHYCPFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N6O/c1-10(21)7-15-13-12-14(17-9-16-13)20(19-18-12)8-11-5-3-2-4-6-11/h2-6,9-10,21H,7-8H2,1H3,(H,15,16,17).
What are the key properties of 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol has a molecular weight of 284.32 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-benzyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol is sourced from PubChem (CID 3230765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).