C13H17N5 — CID 3231155
6-methyl-N-prop-2-enyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine (PubChem CID 3231155) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-methyl-N-prop-2-enyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine.
| Compound Name | 6-methyl-N-prop-2-enyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine |
|---|---|
| PubChem CID | 3231155 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 6-methyl-N-prop-2-enyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-9-amine |
| SMILES | C=CCNc1c2c(nc3ncnn13)CC(C)CC2 |
| InChI | InChI=1S/C13H17N5/c1-3-6-14-12-10-5-4-9(2)7-11(10)17-13-15-8-16-18(12)13/h3,8-9,14H,1,4-7H2,2H3 |
| InChIKey | MZKVNHNPGJCHNM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|