C11H14N6 — CID 3231396
N-prop-2-enyl-5,6,7,8-tetrahydrotetrazolo[5,1-b]quinazolin-9-amine (PubChem CID 3231396) has the molecular formula C11H14N6 and a molecular weight of 230.27 g/mol. Its IUPAC name is N-prop-2-enyl-5,6,7,8-tetrahydrotetrazolo[5,1-b]quinazolin-9-amine.
| Compound Name | N-prop-2-enyl-5,6,7,8-tetrahydrotetrazolo[5,1-b]quinazolin-9-amine |
|---|---|
| PubChem CID | 3231396 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N-prop-2-enyl-5,6,7,8-tetrahydrotetrazolo[5,1-b]quinazolin-9-amine |
| SMILES | C=CCNc1c2c(nc3nnnn13)CCCC2 |
| InChI | InChI=1S/C11H14N6/c1-2-7-12-10-8-5-3-4-6-9(8)13-11-14-15-16-17(10)11/h2,12H,1,3-7H2 |
| InChIKey | ZSGBOAMRFOYKHN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|