C15H22ClNO2 — CID 32321
Delachlor (PubChem CID 32321) has the molecular formula C15H22ClNO2 and a molecular weight of 283.79 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methylpropoxymethyl)acetamide.
| Compound Name | Delachlor |
|---|---|
| PubChem CID | 32321 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.79 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methylpropoxymethyl)acetamide |
| SMILES | CC1=C(C(=CC=C1)C)N(COCC(C)C)C(=O)CCl |
| InChIKey | BIQOEDQVNIYWPQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 0 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 273 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|