C28H31N5O3 — CID 3232141
N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 3232141) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3232141 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc4c(c3)[nH]c(=O)n4Cc3ccc(OC)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H31N5O3/c1-3-31-14-16-32(17-15-31)23-9-7-22(8-10-23)29-27(34)21-6-13-26-25(18-21)30-28(35)33(26)19-20-4-11-24(36-2)12-5-20/h4-13,18H,3,14-17,19H2,1-2H3,(H,29,34)(H,30,35) |
| InChIKey | VDZRKCWCPDTKLA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|