About 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide
5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide (PubChem CID 3232303) has the molecular formula C18H11ClN4O2S
and a molecular weight of 382.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 3232303 |
| Molecular Formula | C18H11ClN4O2S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ncc(-c2cccnc2)s1)c1ncoc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11ClN4O2S/c19-13-5-3-11(4-6-13)16-15(22-10-25-16)17(24)23-18-21-9-14(26-18)12-2-1-7-20-8-12/h1-10H,(H,21,23,24) |
| InChIKey | HVQQIJWIAGATHB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide (CID 3232303) is 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide is O=C(Nc1ncc(-c2cccnc2)s1)c1ncoc1-c1ccc(Cl)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
The InChIKey is HVQQIJWIAGATHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11ClN4O2S/c19-13-5-3-11(4-6-13)16-15(22-10-25-16)17(24)23-18-21-9-14(26-18)12-2-1-7-20-8-12/h1-10H,(H,21,23,24).
What are the key properties of 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide?
5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide has a molecular weight of 382.83 g/mol, XLogP of 4.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-N-(5-pyridin-3-yl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 3232303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).