C27H31N3O4S — CID 3232423
2-acetamido-3-(4-methylphenyl)-N-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)propanamide (PubChem CID 3232423) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-acetamido-3-(4-methylphenyl)-N-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)propanamide.
| Compound Name | 2-acetamido-3-(4-methylphenyl)-N-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 3232423 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-acetamido-3-(4-methylphenyl)-N-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)propanamide |
| SMILES | CC(=O)NC(Cc1ccc(C)cc1)C(=O)NC1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C27H31N3O4S/c1-19-7-9-21(10-8-19)17-26(28-20(2)31)27(32)29-24-13-15-30(16-14-24)35(33,34)25-12-11-22-5-3-4-6-23(22)18-25/h3-12,18,24,26H,13-17H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | MHHYLMLXJYCRBV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |