C24H21N3O4 — CID 3232610
6-(1,3-benzodioxol-5-yl)-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 3232610) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 3232610 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-N-[(2,4-dimethoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3ccc(-c4ccc5c(c4)OCO5)cc23)c(OC)c1 |
| InChI | InChI=1S/C24H21N3O4/c1-28-18-6-3-17(22(11-18)29-2)12-25-24-19-9-15(4-7-20(19)26-13-27-24)16-5-8-21-23(10-16)31-14-30-21/h3-11,13H,12,14H2,1-2H3,(H,25,26,27) |
| InChIKey | AYGHTCXPRYESOL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |