About 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine
6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine (PubChem CID 3232664) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine |
| PubChem CID | 3232664 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine |
| SMILES | COCCNc1ncnc2ccc(-c3c(C)noc3C)cc12 |
| InChI | InChI=1S/C16H18N4O2/c1-10-15(11(2)22-20-10)12-4-5-14-13(8-12)16(19-9-18-14)17-6-7-21-3/h4-5,8-9H,6-7H2,1-3H3,(H,17,18,19) |
| InChIKey | VETFLZQPBBYFLI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine?
The IUPAC name of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine (CID 3232664) is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine.
What is the SMILES notation for 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine?
The canonical SMILES for 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine is COCCNc1ncnc2ccc(-c3c(C)noc3C)cc12.
What is the InChIKey of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine?
The InChIKey is VETFLZQPBBYFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2/c1-10-15(11(2)22-20-10)12-4-5-14-13(8-12)16(19-9-18-14)17-6-7-21-3/h4-5,8-9H,6-7H2,1-3H3,(H,17,18,19).
What are the key properties of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine?
6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine has a molecular weight of 298.35 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)quinazolin-4-amine is sourced from PubChem (CID 3232664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).