About (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone
(4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone (PubChem CID 3232719) has the molecular formula C21H27N3O2S
and a molecular weight of 385.53 g/mol. Its IUPAC name is (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone |
| PubChem CID | 3232719 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC3(CCN(Cc4nccs4)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3O2S/c1-26-18-4-2-17(3-5-18)20(25)24-13-8-21(9-14-24)6-11-23(12-7-21)16-19-22-10-15-27-19/h2-5,10,15H,6-9,11-14,16H2,1H3 |
| InChIKey | BIQKLAPWLJOMLJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone?
The IUPAC name of (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone (CID 3232719) is (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone.
What is the SMILES notation for (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone?
The canonical SMILES for (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone is COc1ccc(C(=O)N2CCC3(CCN(Cc4nccs4)CC3)CC2)cc1.
What is the InChIKey of (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone?
The InChIKey is BIQKLAPWLJOMLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O2S/c1-26-18-4-2-17(3-5-18)20(25)24-13-8-21(9-14-24)6-11-23(12-7-21)16-19-22-10-15-27-19/h2-5,10,15H,6-9,11-14,16H2,1H3.
What are the key properties of (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone?
(4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone has a molecular weight of 385.53 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]methanone is sourced from PubChem (CID 3232719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).