About [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone
[2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone (PubChem CID 3232750) has the molecular formula C26H28N4O
and a molecular weight of 412.54 g/mol. Its IUPAC name is [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone.
Molecular Properties
| Compound Name | [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone |
| PubChem CID | 3232750 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCC2(CCCN(c3ccc(-c4ccccc4)cc3)C2)CC1 |
| InChI | InChI=1S/C26H28N4O/c31-25(24-19-27-14-15-28-24)29-17-12-26(13-18-29)11-4-16-30(20-26)23-9-7-22(8-10-23)21-5-2-1-3-6-21/h1-3,5-10,14-15,19H,4,11-13,16-18,20H2 |
| InChIKey | FIZXQXATBUPVQM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone?
The IUPAC name of [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone (CID 3232750) is [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone.
What is the SMILES notation for [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone?
The canonical SMILES for [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone is O=C(c1cnccn1)N1CCC2(CCCN(c3ccc(-c4ccccc4)cc3)C2)CC1.
What is the InChIKey of [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone?
The InChIKey is FIZXQXATBUPVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N4O/c31-25(24-19-27-14-15-28-24)29-17-12-26(13-18-29)11-4-16-30(20-26)23-9-7-22(8-10-23)21-5-2-1-3-6-21/h1-3,5-10,14-15,19H,4,11-13,16-18,20H2.
What are the key properties of [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone?
[2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone has a molecular weight of 412.54 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-phenylphenyl)-2,9-diazaspiro[5.5]undecan-9-yl]-pyrazin-2-ylmethanone is sourced from PubChem (CID 3232750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).