About methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate
methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 3232785) has the molecular formula C23H28N2O2
and a molecular weight of 364.49 g/mol. Its IUPAC name is methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate.
Molecular Properties
| Compound Name | methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate |
| PubChem CID | 3232785 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | COC(=O)N1CCC[C@@]2(CCN(C(c3ccccc3)c3ccccc3)C2)C1 |
| InChI | InChI=1S/C23H28N2O2/c1-27-22(26)25-15-8-13-23(18-25)14-16-24(17-23)21(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-7,9-12,21H,8,13-18H2,1H3/t23-/m0/s1 |
| InChIKey | KKPYYEIHMSFECK-QHCPKHFHSA-N |
| XLogP | 4.33 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate?
The IUPAC name of methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate (CID 3232785) is methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate.
What is the SMILES notation for methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate?
The canonical SMILES for methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate is COC(=O)N1CCC[C@@]2(CCN(C(c3ccccc3)c3ccccc3)C2)C1.
What is the InChIKey of methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate?
The InChIKey is KKPYYEIHMSFECK-QHCPKHFHSA-N. The full InChI is InChI=1S/C23H28N2O2/c1-27-22(26)25-15-8-13-23(18-25)14-16-24(17-23)21(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-7,9-12,21H,8,13-18H2,1H3/t23-/m0/s1.
What are the key properties of methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate?
methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate has a molecular weight of 364.49 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5S)-2-benzhydryl-2,7-diazaspiro[4.5]decane-7-carboxylate is sourced from PubChem (CID 3232785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).