About (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone
(2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone (PubChem CID 3232951) has the molecular formula C25H28N4OS
and a molecular weight of 432.59 g/mol. Its IUPAC name is (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone |
| PubChem CID | 3232951 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone |
| SMILES | O=C(c1csnn1)N1CCC2(CCCN(C(c3ccccc3)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C25H28N4OS/c30-24(22-18-31-27-26-22)28-16-13-25(14-17-28)12-7-15-29(19-25)23(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,18,23H,7,12-17,19H2 |
| InChIKey | XWQFNVMBBFVEFC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone?
The IUPAC name of (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone (CID 3232951) is (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone.
What is the SMILES notation for (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone?
The canonical SMILES for (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone is O=C(c1csnn1)N1CCC2(CCCN(C(c3ccccc3)c3ccccc3)C2)CC1.
What is the InChIKey of (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone?
The InChIKey is XWQFNVMBBFVEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N4OS/c30-24(22-18-31-27-26-22)28-16-13-25(14-17-28)12-7-15-29(19-25)23(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,18,23H,7,12-17,19H2.
What are the key properties of (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone?
(2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone has a molecular weight of 432.59 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzhydryl-2,9-diazaspiro[5.5]undecan-9-yl)-(thiadiazol-4-yl)methanone is sourced from PubChem (CID 3232951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).