About 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine
5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine (PubChem CID 3233032) has the molecular formula C19H17N3O2
and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine |
| PubChem CID | 3233032 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine |
| SMILES | Cc1cccc(CNc2ncncc2-c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H17N3O2/c1-13-3-2-4-14(7-13)9-21-19-16(10-20-11-22-19)15-5-6-17-18(8-15)24-12-23-17/h2-8,10-11H,9,12H2,1H3,(H,20,21,22) |
| InChIKey | BAXFJLFGZNSWBF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine?
The IUPAC name of 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine (CID 3233032) is 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine.
What is the SMILES notation for 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine?
The canonical SMILES for 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine is Cc1cccc(CNc2ncncc2-c2ccc3c(c2)OCO3)c1.
What is the InChIKey of 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine?
The InChIKey is BAXFJLFGZNSWBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O2/c1-13-3-2-4-14(7-13)9-21-19-16(10-20-11-22-19)15-5-6-17-18(8-15)24-12-23-17/h2-8,10-11H,9,12H2,1H3,(H,20,21,22).
What are the key properties of 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine?
5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine has a molecular weight of 319.36 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-yl)-N-[(3-methylphenyl)methyl]pyrimidin-4-amine is sourced from PubChem (CID 3233032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).