C19H13FN4O — CID 3233076
8-[(4-fluorophenyl)methyl]-6-phenylpteridin-7-one (PubChem CID 3233076) has the molecular formula C19H13FN4O and a molecular weight of 332.34 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)methyl]-6-phenylpteridin-7-one.
| Compound Name | 8-[(4-fluorophenyl)methyl]-6-phenylpteridin-7-one |
|---|---|
| PubChem CID | 3233076 |
| Molecular Formula | C19H13FN4O |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 8-[(4-fluorophenyl)methyl]-6-phenylpteridin-7-one |
| SMILES | O=c1c(-c2ccccc2)nc2cncnc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H13FN4O/c20-15-8-6-13(7-9-15)11-24-18-16(10-21-12-22-18)23-17(19(24)25)14-4-2-1-3-5-14/h1-10,12H,11H2 |
| InChIKey | CUQQCHJRTDOXFH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |