About Elucaine
Elucaine (PubChem CID 32331) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is [2-(diethylamino)-1-phenylethyl] benzoate.
Molecular Properties
| Compound Name | Elucaine |
| PubChem CID | 32331 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [2-(diethylamino)-1-phenylethyl] benzoate |
| SMILES | CCN(CC)CC(C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C19H23NO2/c1-3-20(4-2)15-18(16-11-7-5-8-12-16)22-19(21)17-13-9-6-10-14-17/h5-14,18H,3-4,15H2,1-2H3 |
| InChIKey | AVXDZNOJIVOGRR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | 315 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Elucaine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Elucaine?
The IUPAC name of Elucaine (CID 32331) is [2-(diethylamino)-1-phenylethyl] benzoate.
What is the SMILES notation for Elucaine?
The canonical SMILES for Elucaine is CCN(CC)CC(C1=CC=CC=C1)OC(=O)C2=CC=CC=C2.
What is the InChIKey of Elucaine?
The InChIKey is AVXDZNOJIVOGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO2/c1-3-20(4-2)15-18(16-11-7-5-8-12-16)22-19(21)17-13-9-6-10-14-17/h5-14,18H,3-4,15H2,1-2H3.
What are the key properties of Elucaine?
Elucaine has a molecular weight of 297.40 g/mol, XLogP of 4.10, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Elucaine is sourced from PubChem (CID 32331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).