C18H21N5O — CID 3233101
6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-piperidin-4-ylquinazolin-4-amine (PubChem CID 3233101) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-piperidin-4-ylquinazolin-4-amine.
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-piperidin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 3233101 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-piperidin-4-ylquinazolin-4-amine |
| SMILES | Cc1noc(C)c1-c1ccc2ncnc(NC3CCNCC3)c2c1 |
| InChI | InChI=1S/C18H21N5O/c1-11-17(12(2)24-23-11)13-3-4-16-15(9-13)18(21-10-20-16)22-14-5-7-19-8-6-14/h3-4,9-10,14,19H,5-8H2,1-2H3,(H,20,21,22) |
| InChIKey | MDYSDJUCIHVMDB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |