About 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone
2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone (PubChem CID 3233136) has the molecular formula C16H25N3O2S
and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone.
Molecular Properties
| Compound Name | 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone |
| PubChem CID | 3233136 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone |
| SMILES | COCC(=O)N1CCC2(CCN(Cc3nccs3)CC2)CC1 |
| InChI | InChI=1S/C16H25N3O2S/c1-21-13-15(20)19-9-4-16(5-10-19)2-7-18(8-3-16)12-14-17-6-11-22-14/h6,11H,2-5,7-10,12-13H2,1H3 |
| InChIKey | SLMIHKUANDWIPI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone?
The IUPAC name of 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone (CID 3233136) is 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone.
What is the SMILES notation for 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone?
The canonical SMILES for 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone is COCC(=O)N1CCC2(CCN(Cc3nccs3)CC2)CC1.
What is the InChIKey of 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone?
The InChIKey is SLMIHKUANDWIPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2S/c1-21-13-15(20)19-9-4-16(5-10-19)2-7-18(8-3-16)12-14-17-6-11-22-14/h6,11H,2-5,7-10,12-13H2,1H3.
What are the key properties of 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone?
2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone has a molecular weight of 323.46 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-[9-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-3-yl]ethanone is sourced from PubChem (CID 3233136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).