About phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate
phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 3233243) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate.
Molecular Properties
| Compound Name | phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate |
| PubChem CID | 3233243 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | CN1CC[C@@]2(CCCN(C(=O)Oc3ccccc3)C2)C1 |
| InChI | InChI=1S/C16H22N2O2/c1-17-11-9-16(12-17)8-5-10-18(13-16)15(19)20-14-6-3-2-4-7-14/h2-4,6-7H,5,8-13H2,1H3/t16-/m0/s1 |
| InChIKey | PZXUCEVKCCWVRO-INIZCTEOSA-N |
| XLogP | 2.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate?
The IUPAC name of phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate (CID 3233243) is phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate.
What is the SMILES notation for phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate?
The canonical SMILES for phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate is CN1CC[C@@]2(CCCN(C(=O)Oc3ccccc3)C2)C1.
What is the InChIKey of phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate?
The InChIKey is PZXUCEVKCCWVRO-INIZCTEOSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-17-11-9-16(12-17)8-5-10-18(13-16)15(19)20-14-6-3-2-4-7-14/h2-4,6-7H,5,8-13H2,1H3/t16-/m0/s1.
What are the key properties of phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate?
phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate has a molecular weight of 274.36 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (5S)-2-methyl-2,7-diazaspiro[4.5]decane-7-carboxylate is sourced from PubChem (CID 3233243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).