About 2-methoxy-6,8-dimethylpteridin-7-one
2-methoxy-6,8-dimethylpteridin-7-one (PubChem CID 3233249) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-methoxy-6,8-dimethylpteridin-7-one.
Molecular Properties
| Compound Name | 2-methoxy-6,8-dimethylpteridin-7-one |
| PubChem CID | 3233249 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-methoxy-6,8-dimethylpteridin-7-one |
| SMILES | COc1ncc2nc(C)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C9H10N4O2/c1-5-8(14)13(2)7-6(11-5)4-10-9(12-7)15-3/h4H,1-3H3 |
| InChIKey | GXRODQBERRCNQU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methoxy-6,8-dimethylpteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6,8-dimethylpteridin-7-one?
The IUPAC name of 2-methoxy-6,8-dimethylpteridin-7-one (CID 3233249) is 2-methoxy-6,8-dimethylpteridin-7-one.
What is the SMILES notation for 2-methoxy-6,8-dimethylpteridin-7-one?
The canonical SMILES for 2-methoxy-6,8-dimethylpteridin-7-one is COc1ncc2nc(C)c(=O)n(C)c2n1.
What is the InChIKey of 2-methoxy-6,8-dimethylpteridin-7-one?
The InChIKey is GXRODQBERRCNQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-5-8(14)13(2)7-6(11-5)4-10-9(12-7)15-3/h4H,1-3H3.
What are the key properties of 2-methoxy-6,8-dimethylpteridin-7-one?
2-methoxy-6,8-dimethylpteridin-7-one has a molecular weight of 206.20 g/mol, XLogP of 0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6,8-dimethylpteridin-7-one is sourced from PubChem (CID 3233249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).