About 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane
2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 3233309) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 3233309 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | c1cnc(N2CC3(CCNCC3)C2)nc1 |
| InChI | InChI=1S/C11H16N4/c1-4-13-10(14-5-1)15-8-11(9-15)2-6-12-7-3-11/h1,4-5,12H,2-3,6-9H2 |
| InChIKey | PSSHFACNLAZRIA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane (CID 3233309) is 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane is c1cnc(N2CC3(CCNCC3)C2)nc1.
What is the InChIKey of 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane?
The InChIKey is PSSHFACNLAZRIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-4-13-10(14-5-1)15-8-11(9-15)2-6-12-7-3-11/h1,4-5,12H,2-3,6-9H2.
What are the key properties of 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane?
2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane has a molecular weight of 204.28 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-2-yl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 3233309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).