About 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine
6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine (PubChem CID 3233354) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine.
Molecular Properties
| Compound Name | 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine |
| PubChem CID | 3233354 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine |
| SMILES | CNc1ncnc2ccc(-c3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C16H13N3O2/c1-17-16-12-6-10(2-4-13(12)18-8-19-16)11-3-5-14-15(7-11)21-9-20-14/h2-8H,9H2,1H3,(H,17,18,19) |
| InChIKey | JQHXFMWAYFJYJC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine?
The IUPAC name of 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine (CID 3233354) is 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine.
What is the SMILES notation for 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine?
The canonical SMILES for 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine is CNc1ncnc2ccc(-c3ccc4c(c3)OCO4)cc12.
What is the InChIKey of 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine?
The InChIKey is JQHXFMWAYFJYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c1-17-16-12-6-10(2-4-13(12)18-8-19-16)11-3-5-14-15(7-11)21-9-20-14/h2-8H,9H2,1H3,(H,17,18,19).
What are the key properties of 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine?
6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine has a molecular weight of 279.30 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzodioxol-5-yl)-N-methylquinazolin-4-amine is sourced from PubChem (CID 3233354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).