About (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane
(5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane (PubChem CID 3233405) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane |
| PubChem CID | 3233405 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane |
| SMILES | c1ccc(N2CC[C@@]3(CCCNC3)C2)nc1 |
| InChI | InChI=1S/C13H19N3/c1-2-8-15-12(4-1)16-9-6-13(11-16)5-3-7-14-10-13/h1-2,4,8,14H,3,5-7,9-11H2/t13-/m1/s1 |
| InChIKey | LGAFOJWLXLMHLW-CYBMUJFWSA-N |
| XLogP | 1.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane?
The IUPAC name of (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane (CID 3233405) is (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane?
The canonical SMILES for (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane is c1ccc(N2CC[C@@]3(CCCNC3)C2)nc1.
What is the InChIKey of (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane?
The InChIKey is LGAFOJWLXLMHLW-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H19N3/c1-2-8-15-12(4-1)16-9-6-13(11-16)5-3-7-14-10-13/h1-2,4,8,14H,3,5-7,9-11H2/t13-/m1/s1.
What are the key properties of (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane?
(5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane has a molecular weight of 217.32 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-pyridin-2-yl-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 3233405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).