About pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone
pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone (PubChem CID 3233422) has the molecular formula C18H22N4OS
and a molecular weight of 342.47 g/mol. Its IUPAC name is pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone.
Molecular Properties
| Compound Name | pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone |
| PubChem CID | 3233422 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone |
| SMILES | O=C(c1ccncc1)N1CCC[C@@]2(CCN(Cc3nccs3)C2)C1 |
| InChI | InChI=1S/C18H22N4OS/c23-17(15-2-6-19-7-3-15)22-9-1-4-18(14-22)5-10-21(13-18)12-16-20-8-11-24-16/h2-3,6-8,11H,1,4-5,9-10,12-14H2/t18-/m0/s1 |
| InChIKey | WAWQVWQZTXTNMV-SFHVURJKSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone?
The IUPAC name of pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone (CID 3233422) is pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone.
What is the SMILES notation for pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone?
The canonical SMILES for pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone is O=C(c1ccncc1)N1CCC[C@@]2(CCN(Cc3nccs3)C2)C1.
What is the InChIKey of pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone?
The InChIKey is WAWQVWQZTXTNMV-SFHVURJKSA-N. The full InChI is InChI=1S/C18H22N4OS/c23-17(15-2-6-19-7-3-15)22-9-1-4-18(14-22)5-10-21(13-18)12-16-20-8-11-24-16/h2-3,6-8,11H,1,4-5,9-10,12-14H2/t18-/m0/s1.
What are the key properties of pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone?
pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone has a molecular weight of 342.47 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-yl-[(5S)-2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[4.5]decan-7-yl]methanone is sourced from PubChem (CID 3233422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).