C17H19N5O2 — CID 3233433
N-[2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)quinazolin-4-yl]amino]ethyl]acetamide (PubChem CID 3233433) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)quinazolin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)quinazolin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 3233433 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)quinazolin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(-c2c(C)noc2C)nc2ccccc12 |
| InChI | InChI=1S/C17H19N5O2/c1-10-15(11(2)24-22-10)17-20-14-7-5-4-6-13(14)16(21-17)19-9-8-18-12(3)23/h4-7H,8-9H2,1-3H3,(H,18,23)(H,19,20,21) |
| InChIKey | HLYULGIODFRLCG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|