C16H13ClN4 — CID 3233435
6-(2-chlorophenyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 3233435) has the molecular formula C16H13ClN4 and a molecular weight of 296.76 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-(2-chlorophenyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3233435 |
| Molecular Formula | C16H13ClN4 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 6-(2-chlorophenyl)-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Clc1ccccc1-c1cc(NCc2cccnc2)ncn1 |
| InChI | InChI=1S/C16H13ClN4/c17-14-6-2-1-5-13(14)15-8-16(21-11-20-15)19-10-12-4-3-7-18-9-12/h1-9,11H,10H2,(H,19,20,21) |
| InChIKey | UHXJSWYMYPPQFE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |