C22H18F2N6O — CID 3233487
6-(3,5-difluorophenyl)-8-phenyl-2-piperazin-1-ylpteridin-7-one (PubChem CID 3233487) has the molecular formula C22H18F2N6O and a molecular weight of 420.42 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-8-phenyl-2-piperazin-1-ylpteridin-7-one.
| Compound Name | 6-(3,5-difluorophenyl)-8-phenyl-2-piperazin-1-ylpteridin-7-one |
|---|---|
| PubChem CID | 3233487 |
| Molecular Formula | C22H18F2N6O |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 6-(3,5-difluorophenyl)-8-phenyl-2-piperazin-1-ylpteridin-7-one |
| SMILES | O=c1c(-c2cc(F)cc(F)c2)nc2cnc(N3CCNCC3)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C22H18F2N6O/c23-15-10-14(11-16(24)12-15)19-21(31)30(17-4-2-1-3-5-17)20-18(27-19)13-26-22(28-20)29-8-6-25-7-9-29/h1-5,10-13,25H,6-9H2 |
| InChIKey | XUWAPSCWGPBPHR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |