About 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone
1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone (PubChem CID 3233551) has the molecular formula C24H30N2O2
and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone.
Molecular Properties
| Compound Name | 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone |
| PubChem CID | 3233551 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC[C@@]2(CCN(C(c3ccccc3)c3ccccc3)C2)C1 |
| InChI | InChI=1S/C24H30N2O2/c1-28-17-22(27)25-15-8-13-24(18-25)14-16-26(19-24)23(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,23H,8,13-19H2,1H3/t24-/m1/s1 |
| InChIKey | LUVZVUXYCOSILK-XMMPIXPASA-N |
| XLogP | 3.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone?
The IUPAC name of 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone (CID 3233551) is 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone.
What is the SMILES notation for 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone?
The canonical SMILES for 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone is COCC(=O)N1CCC[C@@]2(CCN(C(c3ccccc3)c3ccccc3)C2)C1.
What is the InChIKey of 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone?
The InChIKey is LUVZVUXYCOSILK-XMMPIXPASA-N. The full InChI is InChI=1S/C24H30N2O2/c1-28-17-22(27)25-15-8-13-24(18-25)14-16-26(19-24)23(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,23H,8,13-19H2,1H3/t24-/m1/s1.
What are the key properties of 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone?
1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone has a molecular weight of 378.52 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-2-methoxyethanone is sourced from PubChem (CID 3233551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).