C19H17FN4O — CID 3233616
4-[4-(4-fluoroanilino)pyrimidin-2-yl]-N,N-dimethylbenzamide (PubChem CID 3233616) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-[4-(4-fluoroanilino)pyrimidin-2-yl]-N,N-dimethylbenzamide.
| Compound Name | 4-[4-(4-fluoroanilino)pyrimidin-2-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 3233616 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-[4-(4-fluoroanilino)pyrimidin-2-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2nccc(Nc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C19H17FN4O/c1-24(2)19(25)14-5-3-13(4-6-14)18-21-12-11-17(23-18)22-16-9-7-15(20)8-10-16/h3-12H,1-2H3,(H,21,22,23) |
| InChIKey | ASHLILDDDYQEIB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |