About 2-(ethylamino)-6,8-dimethylpteridin-7-one
2-(ethylamino)-6,8-dimethylpteridin-7-one (PubChem CID 3233743) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-(ethylamino)-6,8-dimethylpteridin-7-one.
Molecular Properties
| Compound Name | 2-(ethylamino)-6,8-dimethylpteridin-7-one |
| PubChem CID | 3233743 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-(ethylamino)-6,8-dimethylpteridin-7-one |
| SMILES | CCNc1ncc2nc(C)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C10H13N5O/c1-4-11-10-12-5-7-8(14-10)15(3)9(16)6(2)13-7/h5H,4H2,1-3H3,(H,11,12,14) |
| InChIKey | WZRKYSAVLOLXJN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(ethylamino)-6,8-dimethylpteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-6,8-dimethylpteridin-7-one?
The IUPAC name of 2-(ethylamino)-6,8-dimethylpteridin-7-one (CID 3233743) is 2-(ethylamino)-6,8-dimethylpteridin-7-one.
What is the SMILES notation for 2-(ethylamino)-6,8-dimethylpteridin-7-one?
The canonical SMILES for 2-(ethylamino)-6,8-dimethylpteridin-7-one is CCNc1ncc2nc(C)c(=O)n(C)c2n1.
What is the InChIKey of 2-(ethylamino)-6,8-dimethylpteridin-7-one?
The InChIKey is WZRKYSAVLOLXJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c1-4-11-10-12-5-7-8(14-10)15(3)9(16)6(2)13-7/h5H,4H2,1-3H3,(H,11,12,14).
What are the key properties of 2-(ethylamino)-6,8-dimethylpteridin-7-one?
2-(ethylamino)-6,8-dimethylpteridin-7-one has a molecular weight of 219.25 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-6,8-dimethylpteridin-7-one is sourced from PubChem (CID 3233743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).