About 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide
4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide (PubChem CID 3233768) has the molecular formula C26H26N4O3
and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide |
| PubChem CID | 3233768 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(CNc2nc(-c3ccc(C(=O)N(C)C)cc3)nc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C26H26N4O3/c1-30(2)26(31)18-11-9-17(10-12-18)24-28-22-8-6-5-7-21(22)25(29-24)27-16-19-13-14-20(32-3)15-23(19)33-4/h5-15H,16H2,1-4H3,(H,27,28,29) |
| InChIKey | LATAUOIADSTLRG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide?
The IUPAC name of 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide (CID 3233768) is 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide?
The canonical SMILES for 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide is COc1ccc(CNc2nc(-c3ccc(C(=O)N(C)C)cc3)nc3ccccc23)c(OC)c1.
What is the InChIKey of 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide?
The InChIKey is LATAUOIADSTLRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O3/c1-30(2)26(31)18-11-9-17(10-12-18)24-28-22-8-6-5-7-21(22)25(29-24)27-16-19-13-14-20(32-3)15-23(19)33-4/h5-15H,16H2,1-4H3,(H,27,28,29).
What are the key properties of 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide?
4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide has a molecular weight of 442.52 g/mol, XLogP of 4.63, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,4-dimethoxyphenyl)methylamino]quinazolin-2-yl]-N,N-dimethylbenzamide is sourced from PubChem (CID 3233768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).