C20H25N3O2S — CID 3233890
3-(benzenesulfonyl)-9-pyridin-4-yl-3,9-diazaspiro[5.5]undecane (PubChem CID 3233890) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-9-pyridin-4-yl-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(benzenesulfonyl)-9-pyridin-4-yl-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 3233890 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-(benzenesulfonyl)-9-pyridin-4-yl-3,9-diazaspiro[5.5]undecane |
| SMILES | O=S(=O)(c1ccccc1)N1CCC2(CCN(c3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C20H25N3O2S/c24-26(25,19-4-2-1-3-5-19)23-16-10-20(11-17-23)8-14-22(15-9-20)18-6-12-21-13-7-18/h1-7,12-13H,8-11,14-17H2 |
| InChIKey | NMHMVZJUGHQUOC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |