About 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane
7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 3234191) has the molecular formula C18H21N3O2S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 3234191 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | O=S(=O)(c1ccccc1)N1CCC2(CC1)CN(c1ccncc1)C2 |
| InChI | InChI=1S/C18H21N3O2S/c22-24(23,17-4-2-1-3-5-17)21-12-8-18(9-13-21)14-20(15-18)16-6-10-19-11-7-16/h1-7,10-11H,8-9,12-15H2 |
| InChIKey | WJYGGQFASPHFTF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane (CID 3234191) is 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane is O=S(=O)(c1ccccc1)N1CCC2(CC1)CN(c1ccncc1)C2.
What is the InChIKey of 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane?
The InChIKey is WJYGGQFASPHFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2S/c22-24(23,17-4-2-1-3-5-17)21-12-8-18(9-13-21)14-20(15-18)16-6-10-19-11-7-16/h1-7,10-11H,8-9,12-15H2.
What are the key properties of 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane?
7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane has a molecular weight of 343.45 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 3234191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).