About (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone
(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone (PubChem CID 3234238) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone |
| PubChem CID | 3234238 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone |
| SMILES | CN1CCCC2(CCN(C(=O)c3cccn3C)CC2)C1 |
| InChI | InChI=1S/C16H25N3O/c1-17-9-4-6-16(13-17)7-11-19(12-8-16)15(20)14-5-3-10-18(14)2/h3,5,10H,4,6-9,11-13H2,1-2H3 |
| InChIKey | AIPWYRSSDJJKLG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone?
The IUPAC name of (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone (CID 3234238) is (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone.
What is the SMILES notation for (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone?
The canonical SMILES for (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone is CN1CCCC2(CCN(C(=O)c3cccn3C)CC2)C1.
What is the InChIKey of (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone?
The InChIKey is AIPWYRSSDJJKLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O/c1-17-9-4-6-16(13-17)7-11-19(12-8-16)15(20)14-5-3-10-18(14)2/h3,5,10H,4,6-9,11-13H2,1-2H3.
What are the key properties of (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone?
(2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone has a molecular weight of 275.40 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,9-diazaspiro[5.5]undecan-9-yl)-(1-methylpyrrol-2-yl)methanone is sourced from PubChem (CID 3234238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).