About [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone
[(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone (PubChem CID 3234289) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone |
| PubChem CID | 3234289 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone |
| SMILES | CN1CC[C@@]2(CCCN(C(=O)c3cccn3C)C2)C1 |
| InChI | InChI=1S/C15H23N3O/c1-16-10-7-15(11-16)6-4-9-18(12-15)14(19)13-5-3-8-17(13)2/h3,5,8H,4,6-7,9-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | LHASBUWCUHKWOO-HNNXBMFYSA-N |
| XLogP | 1.58 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone?
The IUPAC name of [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone (CID 3234289) is [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone.
What is the SMILES notation for [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone?
The canonical SMILES for [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone is CN1CC[C@@]2(CCCN(C(=O)c3cccn3C)C2)C1.
What is the InChIKey of [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone?
The InChIKey is LHASBUWCUHKWOO-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H23N3O/c1-16-10-7-15(11-16)6-4-9-18(12-15)14(19)13-5-3-8-17(13)2/h3,5,8H,4,6-7,9-12H2,1-2H3/t15-/m0/s1.
What are the key properties of [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone?
[(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone has a molecular weight of 261.37 g/mol, XLogP of 1.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-2-methyl-2,7-diazaspiro[4.5]decan-7-yl]-(1-methylpyrrol-2-yl)methanone is sourced from PubChem (CID 3234289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).