About 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine
5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine (PubChem CID 3234459) has the molecular formula C12H16N4O2
and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine |
| PubChem CID | 3234459 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine |
| SMILES | COCCNc1ncncc1-c1c(C)noc1C |
| InChI | InChI=1S/C12H16N4O2/c1-8-11(9(2)18-16-8)10-6-13-7-15-12(10)14-4-5-17-3/h6-7H,4-5H2,1-3H3,(H,13,14,15) |
| InChIKey | FRGZXVXFYWQGJD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
The IUPAC name of 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine (CID 3234459) is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine.
What is the SMILES notation for 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
The canonical SMILES for 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine is COCCNc1ncncc1-c1c(C)noc1C.
What is the InChIKey of 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
The InChIKey is FRGZXVXFYWQGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2/c1-8-11(9(2)18-16-8)10-6-13-7-15-12(10)14-4-5-17-3/h6-7H,4-5H2,1-3H3,(H,13,14,15).
What are the key properties of 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine?
5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine has a molecular weight of 248.29 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethyl-1,2-oxazol-4-yl)-N-(2-methoxyethyl)pyrimidin-4-amine is sourced from PubChem (CID 3234459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).