About 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone
2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone (PubChem CID 3234517) has the molecular formula C14H21N3O2S
and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone.
Molecular Properties
| Compound Name | 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
| PubChem CID | 3234517 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone |
| SMILES | COCC(=O)N1CCC2(CC1)CN(Cc1nccs1)C2 |
| InChI | InChI=1S/C14H21N3O2S/c1-19-9-13(18)17-5-2-14(3-6-17)10-16(11-14)8-12-15-4-7-20-12/h4,7H,2-3,5-6,8-11H2,1H3 |
| InChIKey | IZHCQDBRKBFJOQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone?
The IUPAC name of 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone (CID 3234517) is 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone.
What is the SMILES notation for 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone?
The canonical SMILES for 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone is COCC(=O)N1CCC2(CC1)CN(Cc1nccs1)C2.
What is the InChIKey of 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone?
The InChIKey is IZHCQDBRKBFJOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O2S/c1-19-9-13(18)17-5-2-14(3-6-17)10-16(11-14)8-12-15-4-7-20-12/h4,7H,2-3,5-6,8-11H2,1H3.
What are the key properties of 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone?
2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone has a molecular weight of 295.41 g/mol, XLogP of 1.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-[2-(1,3-thiazol-2-ylmethyl)-2,7-diazaspiro[3.5]nonan-7-yl]ethanone is sourced from PubChem (CID 3234517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).