About [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone
[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone (PubChem CID 3234612) has the molecular formula C26H28N4O
and a molecular weight of 412.54 g/mol. Its IUPAC name is [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone.
Molecular Properties
| Compound Name | [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone |
| PubChem CID | 3234612 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCC[C@@]2(CCN(C(c3ccccc3)c3ccccc3)C2)C1 |
| InChI | InChI=1S/C26H28N4O/c31-25(23-18-27-14-15-28-23)30-16-7-12-26(20-30)13-17-29(19-26)24(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-6,8-11,14-15,18,24H,7,12-13,16-17,19-20H2/t26-/m0/s1 |
| InChIKey | MZPAIAIQWSLVAU-SANMLTNESA-N |
| XLogP | 4.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone?
The IUPAC name of [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone (CID 3234612) is [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone.
What is the SMILES notation for [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone?
The canonical SMILES for [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone is O=C(c1cnccn1)N1CCC[C@@]2(CCN(C(c3ccccc3)c3ccccc3)C2)C1.
What is the InChIKey of [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone?
The InChIKey is MZPAIAIQWSLVAU-SANMLTNESA-N. The full InChI is InChI=1S/C26H28N4O/c31-25(23-18-27-14-15-28-23)30-16-7-12-26(20-30)13-17-29(19-26)24(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-6,8-11,14-15,18,24H,7,12-13,16-17,19-20H2/t26-/m0/s1.
What are the key properties of [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone?
[(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone has a molecular weight of 412.54 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-2-benzhydryl-2,7-diazaspiro[4.5]decan-7-yl]-pyrazin-2-ylmethanone is sourced from PubChem (CID 3234612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).