About 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane
7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane (PubChem CID 3234678) has the molecular formula C14H20N2O2S
and a molecular weight of 280.39 g/mol. Its IUPAC name is 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 3234678 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CS(=O)(=O)N1CCC2(CC1)CN(c1ccccc1)C2 |
| InChI | InChI=1S/C14H20N2O2S/c1-19(17,18)16-9-7-14(8-10-16)11-15(12-14)13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChIKey | SKQACBPXFNKMNG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane (CID 3234678) is 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane is CS(=O)(=O)N1CCC2(CC1)CN(c1ccccc1)C2.
What is the InChIKey of 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is SKQACBPXFNKMNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2S/c1-19(17,18)16-9-7-14(8-10-16)11-15(12-14)13-5-3-2-4-6-13/h2-6H,7-12H2,1H3.
What are the key properties of 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane?
7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 280.39 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylsulfonyl-2-phenyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 3234678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).