C23H20N4O — CID 3234748
4-(4-anilinoquinazolin-2-yl)-N,N-dimethylbenzamide (PubChem CID 3234748) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-(4-anilinoquinazolin-2-yl)-N,N-dimethylbenzamide.
| Compound Name | 4-(4-anilinoquinazolin-2-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 3234748 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-(4-anilinoquinazolin-2-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2nc(Nc3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H20N4O/c1-27(2)23(28)17-14-12-16(13-15-17)21-25-20-11-7-6-10-19(20)22(26-21)24-18-8-4-3-5-9-18/h3-15H,1-2H3,(H,24,25,26) |
| InChIKey | QBFKXNTXAMSFNZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |