About methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate
methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 3234894) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate.
Molecular Properties
| Compound Name | methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate |
| PubChem CID | 3234894 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | COC(=O)N1CCC2(CCCN(c3ncccn3)C2)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-21-14(20)18-10-5-15(6-11-18)4-2-9-19(12-15)13-16-7-3-8-17-13/h3,7-8H,2,4-6,9-12H2,1H3 |
| InChIKey | IIKZWEDEHISMCO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate?
The IUPAC name of methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate (CID 3234894) is methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate.
What is the SMILES notation for methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate?
The canonical SMILES for methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate is COC(=O)N1CCC2(CCCN(c3ncccn3)C2)CC1.
What is the InChIKey of methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate?
The InChIKey is IIKZWEDEHISMCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-21-14(20)18-10-5-15(6-11-18)4-2-9-19(12-15)13-16-7-3-8-17-13/h3,7-8H,2,4-6,9-12H2,1H3.
What are the key properties of methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate?
methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate has a molecular weight of 290.37 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecane-9-carboxylate is sourced from PubChem (CID 3234894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).