About phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate
phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 3234937) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate.
Molecular Properties
| Compound Name | phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| PubChem CID | 3234937 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | CN1CCC2(CC1)CCN(C(=O)Oc1ccccc1)CC2 |
| InChI | InChI=1S/C17H24N2O2/c1-18-11-7-17(8-12-18)9-13-19(14-10-17)16(20)21-15-5-3-2-4-6-15/h2-6H,7-14H2,1H3 |
| InChIKey | LMZHVQCCLWZZPX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate?
The IUPAC name of phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate (CID 3234937) is phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate.
What is the SMILES notation for phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate?
The canonical SMILES for phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate is CN1CCC2(CC1)CCN(C(=O)Oc1ccccc1)CC2.
What is the InChIKey of phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate?
The InChIKey is LMZHVQCCLWZZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-18-11-7-17(8-12-18)9-13-19(14-10-17)16(20)21-15-5-3-2-4-6-15/h2-6H,7-14H2,1H3.
What are the key properties of phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate?
phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate has a molecular weight of 288.39 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 9-methyl-3,9-diazaspiro[5.5]undecane-3-carboxylate is sourced from PubChem (CID 3234937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).