About (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane
(5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane (PubChem CID 3235014) has the molecular formula C13H20N4O2S
and a molecular weight of 296.40 g/mol. Its IUPAC name is (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane |
| PubChem CID | 3235014 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane |
| SMILES | CS(=O)(=O)N1CCC[C@@]2(CCN(c3ncccn3)C2)C1 |
| InChI | InChI=1S/C13H20N4O2S/c1-20(18,19)17-8-2-4-13(11-17)5-9-16(10-13)12-14-6-3-7-15-12/h3,6-7H,2,4-5,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | VMTLXCKKBVOZDT-ZDUSSCGKSA-N |
| XLogP | 0.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane?
The IUPAC name of (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane (CID 3235014) is (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane?
The canonical SMILES for (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane is CS(=O)(=O)N1CCC[C@@]2(CCN(c3ncccn3)C2)C1.
What is the InChIKey of (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane?
The InChIKey is VMTLXCKKBVOZDT-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H20N4O2S/c1-20(18,19)17-8-2-4-13(11-17)5-9-16(10-13)12-14-6-3-7-15-12/h3,6-7H,2,4-5,8-11H2,1H3/t13-/m0/s1.
What are the key properties of (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane?
(5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane has a molecular weight of 296.40 g/mol, XLogP of 0.73, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-methylsulfonyl-2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 3235014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).