About (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane
(5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane (PubChem CID 3235210) has the molecular formula C21H26N2O2S
and a molecular weight of 370.52 g/mol. Its IUPAC name is (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane |
| PubChem CID | 3235210 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccccc1)N1CCC[C@@]2(CCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C21H26N2O2S/c24-26(25,20-10-5-2-6-11-20)23-14-7-12-21(18-23)13-15-22(17-21)16-19-8-3-1-4-9-19/h1-6,8-11H,7,12-18H2/t21-/m0/s1 |
| InChIKey | PEWXOCODKBSOFL-NRFANRHFSA-N |
| XLogP | 3.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane?
The IUPAC name of (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane (CID 3235210) is (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane?
The canonical SMILES for (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane is O=S(=O)(c1ccccc1)N1CCC[C@@]2(CCN(Cc3ccccc3)C2)C1.
What is the InChIKey of (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane?
The InChIKey is PEWXOCODKBSOFL-NRFANRHFSA-N. The full InChI is InChI=1S/C21H26N2O2S/c24-26(25,20-10-5-2-6-11-20)23-14-7-12-21(18-23)13-15-22(17-21)16-19-8-3-1-4-9-19/h1-6,8-11H,7,12-18H2/t21-/m0/s1.
What are the key properties of (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane?
(5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane has a molecular weight of 370.52 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-(benzenesulfonyl)-2-benzyl-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 3235210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).