About 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine
6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine (PubChem CID 3235220) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine |
| PubChem CID | 3235220 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(-c2c(C)noc2C)ncn1 |
| InChI | InChI=1S/C10H12N4O/c1-6-10(7(2)15-14-6)8-4-9(11-3)13-5-12-8/h4-5H,1-3H3,(H,11,12,13) |
| InChIKey | QEIHDOQJCDKQCO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine?
The IUPAC name of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine (CID 3235220) is 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine.
What is the SMILES notation for 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine?
The canonical SMILES for 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine is CNc1cc(-c2c(C)noc2C)ncn1.
What is the InChIKey of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine?
The InChIKey is QEIHDOQJCDKQCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-6-10(7(2)15-14-6)8-4-9(11-3)13-5-12-8/h4-5H,1-3H3,(H,11,12,13).
What are the key properties of 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine?
6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine has a molecular weight of 204.23 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methylpyrimidin-4-amine is sourced from PubChem (CID 3235220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).