About 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one
6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one (PubChem CID 3235384) has the molecular formula C19H19F2N5O2
and a molecular weight of 387.39 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one.
Molecular Properties
| Compound Name | 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one |
| PubChem CID | 3235384 |
| Molecular Formula | C19H19F2N5O2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one |
| SMILES | CCNc1ncc2nc(-c3cc(F)cc(F)c3)c(=O)n(C[C@H]3CCCO3)c2n1 |
| InChI | InChI=1S/C19H19F2N5O2/c1-2-22-19-23-9-15-17(25-19)26(10-14-4-3-5-28-14)18(27)16(24-15)11-6-12(20)8-13(21)7-11/h6-9,14H,2-5,10H2,1H3,(H,22,23,25)/t14-/m1/s1 |
| InChIKey | CWMIRIPYLCPVHY-CQSZACIVSA-N |
| XLogP | 2.74 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one?
The IUPAC name of 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one (CID 3235384) is 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one.
What is the SMILES notation for 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one?
The canonical SMILES for 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one is CCNc1ncc2nc(-c3cc(F)cc(F)c3)c(=O)n(C[C@H]3CCCO3)c2n1.
What is the InChIKey of 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one?
The InChIKey is CWMIRIPYLCPVHY-CQSZACIVSA-N. The full InChI is InChI=1S/C19H19F2N5O2/c1-2-22-19-23-9-15-17(25-19)26(10-14-4-3-5-28-14)18(27)16(24-15)11-6-12(20)8-13(21)7-11/h6-9,14H,2-5,10H2,1H3,(H,22,23,25)/t14-/m1/s1.
What are the key properties of 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one?
6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one has a molecular weight of 387.39 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-difluorophenyl)-2-(ethylamino)-8-[[(2R)-oxolan-2-yl]methyl]pteridin-7-one is sourced from PubChem (CID 3235384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).