About 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide
4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide (PubChem CID 3235503) has the molecular formula C19H18N4O
and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide |
| PubChem CID | 3235503 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2cncnc2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4O/c1-23(2)19(24)15-10-8-14(9-11-15)17-12-20-13-21-18(17)22-16-6-4-3-5-7-16/h3-13H,1-2H3,(H,20,21,22) |
| InChIKey | UYHNZFMACSLUPZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide?
The IUPAC name of 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide (CID 3235503) is 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide.
What is the SMILES notation for 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide?
The canonical SMILES for 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(-c2cncnc2Nc2ccccc2)cc1.
What is the InChIKey of 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide?
The InChIKey is UYHNZFMACSLUPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O/c1-23(2)19(24)15-10-8-14(9-11-15)17-12-20-13-21-18(17)22-16-6-4-3-5-7-16/h3-13H,1-2H3,(H,20,21,22).
What are the key properties of 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide?
4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide has a molecular weight of 318.38 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-anilinopyrimidin-5-yl)-N,N-dimethylbenzamide is sourced from PubChem (CID 3235503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).