About 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one
1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 3235584) has the molecular formula C18H22N4O
and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 3235584 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Cc1ccc(C)c(Cn2cnc3c(cnn3C(C)(C)C)c2=O)c1 |
| InChI | InChI=1S/C18H22N4O/c1-12-6-7-13(2)14(8-12)10-21-11-19-16-15(17(21)23)9-20-22(16)18(3,4)5/h6-9,11H,10H2,1-5H3 |
| InChIKey | SBUZRPHSJBKVMF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one (CID 3235584) is 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one is Cc1ccc(C)c(Cn2cnc3c(cnn3C(C)(C)C)c2=O)c1.
What is the InChIKey of 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is SBUZRPHSJBKVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O/c1-12-6-7-13(2)14(8-12)10-21-11-19-16-15(17(21)23)9-20-22(16)18(3,4)5/h6-9,11H,10H2,1-5H3.
What are the key properties of 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one?
1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 310.40 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-[(2,5-dimethylphenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 3235584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).